C28H31N5O8 — CID 59157995
(4S,4aS,5aR,12aR)-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-7-[2-[(3-methylimidazol-4-yl)methylamino]acetyl]-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 59157995) has the molecular formula C28H31N5O8 and a molecular weight of 565.58 g/mol. Its IUPAC name is (4S,4aS,5aR,12aR)-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-7-[2-[(3-methylimidazol-4-yl)methylamino]acetyl]-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4S,4aS,5aR,12aR)-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-7-[2-[(3-methylimidazol-4-yl)methylamino]acetyl]-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 59157995 |
| Molecular Formula | C28H31N5O8 |
| Molecular Weight | 565.58 g/mol |
| Exact Mass | 565.22 |
| IUPAC Name | (4S,4aS,5aR,12aR)-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-7-[2-[(3-methylimidazol-4-yl)methylamino]acetyl]-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | CN(C)[C@@H]1C(=O)C(C(N)=O)=C(O)[C@@]2(O)C(=O)C3=C(O)c4c(O)ccc(C(=O)CNCc5cncn5C)c4C[C@H]3C[C@@H]12 |
| InChI | InChI=1S/C28H31N5O8/c1-32(2)22-16-7-12-6-15-14(18(35)10-30-8-13-9-31-11-33(13)3)4-5-17(34)20(15)23(36)19(12)25(38)28(16,41)26(39)21(24(22)37)27(29)40/h4-5,9,11-12,16,22,30,34,36,39,41H,6-8,10H2,1-3H3,(H2,29,40)/t12-,16-,22-,28-/m0/s1 |
| InChIKey | ZYCMRFOSLHZFOH-VITAXYRDSA-N |
| XLogP | -0.33 |
| TPSA | 208.31 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.58 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|