C25H29N3O8 — CID 135914641
(4S,12aR)-4-(dimethylamino)-7-[(Z)-N-ethoxy-C-methylcarbonimidoyl]-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 135914641) has the molecular formula C25H29N3O8 and a molecular weight of 499.52 g/mol. Its IUPAC name is (4S,12aR)-4-(dimethylamino)-7-[(Z)-N-ethoxy-C-methylcarbonimidoyl]-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4S,12aR)-4-(dimethylamino)-7-[(Z)-N-ethoxy-C-methylcarbonimidoyl]-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 135914641 |
| Molecular Formula | C25H29N3O8 |
| Molecular Weight | 499.52 g/mol |
| Exact Mass | 499.20 |
| IUPAC Name | (4S,12aR)-4-(dimethylamino)-7-[(Z)-N-ethoxy-C-methylcarbonimidoyl]-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | CCO/N=C(/C)c1ccc(O)c2c1CC1CC3[C@H](N(C)C)C(=O)C(C(N)=O)=C(O)[C@@]3(O)C(=O)C1=C2O |
| InChI | InChI=1S/C25H29N3O8/c1-5-36-27-10(2)12-6-7-15(29)17-13(12)8-11-9-14-19(28(3)4)21(31)18(24(26)34)23(33)25(14,35)22(32)16(11)20(17)30/h6-7,11,14,19,29-30,33,35H,5,8-9H2,1-4H3,(H2,26,34)/b27-10-/t11?,14?,19-,25-/m0/s1 |
| InChIKey | YAZPCHTYSZRRGQ-XYDCUWJZSA-N |
| XLogP | 0.72 |
| TPSA | 182.98 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.52 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|