C22H22N6O7 — CID 54693255
(4aS,5aR,12aR)-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-7-(tetrazol-1-yl)-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 54693255) has the molecular formula C22H22N6O7 and a molecular weight of 482.45 g/mol. Its IUPAC name is (4aS,5aR,12aR)-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-7-(tetrazol-1-yl)-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4aS,5aR,12aR)-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-7-(tetrazol-1-yl)-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 54693255 |
| Molecular Formula | C22H22N6O7 |
| Molecular Weight | 482.45 g/mol |
| Exact Mass | 482.15 |
| IUPAC Name | (4aS,5aR,12aR)-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-7-(tetrazol-1-yl)-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | CN(C)C1C(=O)C(C(N)=O)=C(O)[C@@]2(O)C(=O)C3=C(O)c4c(O)ccc(-n5cnnn5)c4C[C@H]3C[C@@H]12 |
| InChI | InChI=1S/C22H22N6O7/c1-27(2)16-10-6-8-5-9-11(28-7-24-25-26-28)3-4-12(29)14(9)17(30)13(8)19(32)22(10,35)20(33)15(18(16)31)21(23)34/h3-4,7-8,10,16,29-30,33,35H,5-6H2,1-2H3,(H2,23,34)/t8-,10-,16?,22-/m0/s1 |
| InChIKey | XTTZHIHLIWDENZ-BAGYBVSFSA-N |
| XLogP | -1.06 |
| TPSA | 204.99 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.45 |
| LogP ≤ 5 | -1.06 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|