C24H26F3N3O8 — CID 54741468
(4S,4aS,5aR,12aR)-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-7-[(2,2,2-trifluoroethoxyamino)methyl]-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 54741468) has the molecular formula C24H26F3N3O8 and a molecular weight of 541.48 g/mol. Its IUPAC name is (4S,4aS,5aR,12aR)-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-7-[(2,2,2-trifluoroethoxyamino)methyl]-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4S,4aS,5aR,12aR)-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-7-[(2,2,2-trifluoroethoxyamino)methyl]-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 54741468 |
| Molecular Formula | C24H26F3N3O8 |
| Molecular Weight | 541.48 g/mol |
| Exact Mass | 541.17 |
| IUPAC Name | (4S,4aS,5aR,12aR)-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-7-[(2,2,2-trifluoroethoxyamino)methyl]-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | CN(C)[C@@H]1C(=O)C(C(N)=O)=C(O)[C@@]2(O)C(=O)C3=C(O)c4c(O)ccc(CNOCC(F)(F)F)c4C[C@H]3C[C@@H]12 |
| InChI | InChI=1S/C24H26F3N3O8/c1-30(2)17-12-6-10-5-11-9(7-29-38-8-23(25,26)27)3-4-13(31)15(11)18(32)14(10)20(34)24(12,37)21(35)16(19(17)33)22(28)36/h3-4,10,12,17,29,31-32,35,37H,5-8H2,1-2H3,(H2,28,36)/t10-,12-,17-,24-/m0/s1 |
| InChIKey | IVBLSHUDSDKDQW-KGWNKILJSA-N |
| XLogP | 0.55 |
| TPSA | 182.65 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.48 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|