C28H36FN3O7 — CID 159763919
(4aS,5aR,12aR)-7-[(cyclopentylamino)methyl]-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide;fluoromethane (PubChem CID 159763919) has the molecular formula C28H36FN3O7 and a molecular weight of 545.61 g/mol. Its IUPAC name is (4aS,5aR,12aR)-7-[(cyclopentylamino)methyl]-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide;fluoromethane.
| Compound Name | (4aS,5aR,12aR)-7-[(cyclopentylamino)methyl]-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide;fluoromethane |
|---|---|
| PubChem CID | 159763919 |
| Molecular Formula | C28H36FN3O7 |
| Molecular Weight | 545.61 g/mol |
| Exact Mass | 545.25 |
| IUPAC Name | (4aS,5aR,12aR)-7-[(cyclopentylamino)methyl]-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide;fluoromethane |
| SMILES | CF.CN(C)C1C(=O)C(C(N)=O)=C(O)[C@@]2(O)C(=O)C3=C(O)c4c(O)ccc(CNC5CCCC5)c4C[C@H]3C[C@@H]12 |
| InChI | InChI=1S/C27H33N3O7.CH3F/c1-30(2)21-16-10-13-9-15-12(11-29-14-5-3-4-6-14)7-8-17(31)19(15)22(32)18(13)24(34)27(16,37)25(35)20(23(21)33)26(28)36;1-2/h7-8,13-14,16,21,29,31-32,35,37H,3-6,9-11H2,1-2H3,(H2,28,36);1H3/t13-,16-,21?,27-;/m0./s1 |
| InChIKey | HKKRXCTYRLTQBY-RCNUGWCPSA-N |
| XLogP | 1.58 |
| TPSA | 173.42 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.61 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|