C27H33N3O8 — CID 59653935
(4S,4aS,5aR,12aR)-4-(dimethylamino)-7-[(2,2-dimethylpropanoylamino)methyl]-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 59653935) has the molecular formula C27H33N3O8 and a molecular weight of 527.57 g/mol. Its IUPAC name is (4S,4aS,5aR,12aR)-4-(dimethylamino)-7-[(2,2-dimethylpropanoylamino)methyl]-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4S,4aS,5aR,12aR)-4-(dimethylamino)-7-[(2,2-dimethylpropanoylamino)methyl]-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 59653935 |
| Molecular Formula | C27H33N3O8 |
| Molecular Weight | 527.57 g/mol |
| Exact Mass | 527.23 |
| IUPAC Name | (4S,4aS,5aR,12aR)-4-(dimethylamino)-7-[(2,2-dimethylpropanoylamino)methyl]-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | CN(C)[C@@H]1C(=O)C(C(N)=O)=C(O)[C@@]2(O)C(=O)C3=C(O)c4c(O)ccc(CNC(=O)C(C)(C)C)c4C[C@H]3C[C@@H]12 |
| InChI | InChI=1S/C27H33N3O8/c1-26(2,3)25(37)29-10-11-6-7-15(31)17-13(11)8-12-9-14-19(30(4)5)21(33)18(24(28)36)23(35)27(14,38)22(34)16(12)20(17)32/h6-7,12,14,19,31-32,35,38H,8-10H2,1-5H3,(H2,28,36)(H,29,37)/t12-,14-,19-,27-/m0/s1 |
| InChIKey | ONWRMTNIHXYOMP-ZFMPQUCFSA-N |
| XLogP | 0.63 |
| TPSA | 190.49 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.57 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|