C31H32N2O9 — CID 137476474
propan-2-yl 3-[(6aR,10R,10aS,11aR)-8-carbamoyl-10-(dimethylamino)-4,5,6a,7-tetrahydroxy-6,9-dioxo-10a,11,11a,12-tetrahydro-10H-tetracen-1-yl]benzoate (PubChem CID 137476474) has the molecular formula C31H32N2O9 and a molecular weight of 576.60 g/mol. Its IUPAC name is propan-2-yl 3-[(6aR,10R,10aS,11aR)-8-carbamoyl-10-(dimethylamino)-4,5,6a,7-tetrahydroxy-6,9-dioxo-10a,11,11a,12-tetrahydro-10H-tetracen-1-yl]benzoate.
| Compound Name | propan-2-yl 3-[(6aR,10R,10aS,11aR)-8-carbamoyl-10-(dimethylamino)-4,5,6a,7-tetrahydroxy-6,9-dioxo-10a,11,11a,12-tetrahydro-10H-tetracen-1-yl]benzoate |
|---|---|
| PubChem CID | 137476474 |
| Molecular Formula | C31H32N2O9 |
| Molecular Weight | 576.60 g/mol |
| Exact Mass | 576.21 |
| IUPAC Name | propan-2-yl 3-[(6aR,10R,10aS,11aR)-8-carbamoyl-10-(dimethylamino)-4,5,6a,7-tetrahydroxy-6,9-dioxo-10a,11,11a,12-tetrahydro-10H-tetracen-1-yl]benzoate |
| SMILES | CC(C)OC(=O)c1cccc(-c2ccc(O)c3c2C[C@H]2C[C@H]4[C@@H](N(C)C)C(=O)C(C(N)=O)=C(O)[C@@]4(O)C(=O)C2=C3O)c1 |
| InChI | InChI=1S/C31H32N2O9/c1-13(2)42-30(40)15-7-5-6-14(10-15)17-8-9-20(34)22-18(17)11-16-12-19-24(33(3)4)26(36)23(29(32)39)28(38)31(19,41)27(37)21(16)25(22)35/h5-10,13,16,19,24,34-35,38,41H,11-12H2,1-4H3,(H2,32,39)/t16-,19-,24+,31-/m0/s1 |
| InChIKey | JIEQGCLNHQIBID-RGLSGBIZSA-N |
| XLogP | 2.20 |
| TPSA | 187.69 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.60 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|