C29H29N3O9 — CID 54692101
methyl 3-amino-5-[8-carbamoyl-10-(dimethylamino)-4,5,6a,7-tetrahydroxy-6,9-dioxo-10a,11,11a,12-tetrahydro-10H-tetracen-1-yl]benzoate (PubChem CID 54692101) has the molecular formula C29H29N3O9 and a molecular weight of 563.56 g/mol. Its IUPAC name is methyl 3-amino-5-[8-carbamoyl-10-(dimethylamino)-4,5,6a,7-tetrahydroxy-6,9-dioxo-10a,11,11a,12-tetrahydro-10H-tetracen-1-yl]benzoate.
| Compound Name | methyl 3-amino-5-[8-carbamoyl-10-(dimethylamino)-4,5,6a,7-tetrahydroxy-6,9-dioxo-10a,11,11a,12-tetrahydro-10H-tetracen-1-yl]benzoate |
|---|---|
| PubChem CID | 54692101 |
| Molecular Formula | C29H29N3O9 |
| Molecular Weight | 563.56 g/mol |
| Exact Mass | 563.19 |
| IUPAC Name | methyl 3-amino-5-[8-carbamoyl-10-(dimethylamino)-4,5,6a,7-tetrahydroxy-6,9-dioxo-10a,11,11a,12-tetrahydro-10H-tetracen-1-yl]benzoate |
| SMILES | COC(=O)c1cc(N)cc(-c2ccc(O)c3c2CC2CC4C(N(C)C)C(=O)C(C(N)=O)=C(O)C4(O)C(=O)C2=C3O)c1 |
| InChI | InChI=1S/C29H29N3O9/c1-32(2)22-17-10-12-9-16-15(11-6-13(28(39)41-3)8-14(30)7-11)4-5-18(33)20(16)23(34)19(12)25(36)29(17,40)26(37)21(24(22)35)27(31)38/h4-8,12,17,22,33-34,37,40H,9-10,30H2,1-3H3,(H2,31,38) |
| InChIKey | UUJDXBDINVSVAO-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 213.71 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.56 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|