C32H35FN2O7 — CID 158864703
(4S,4aS,5aR,12aR)-4-(dimethylamino)-7-[4-(5-fluoropentan-2-yl)phenyl]-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 158864703) has the molecular formula C32H35FN2O7 and a molecular weight of 578.64 g/mol. Its IUPAC name is (4S,4aS,5aR,12aR)-4-(dimethylamino)-7-[4-(5-fluoropentan-2-yl)phenyl]-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4S,4aS,5aR,12aR)-4-(dimethylamino)-7-[4-(5-fluoropentan-2-yl)phenyl]-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 158864703 |
| Molecular Formula | C32H35FN2O7 |
| Molecular Weight | 578.64 g/mol |
| Exact Mass | 578.24 |
| IUPAC Name | (4S,4aS,5aR,12aR)-4-(dimethylamino)-7-[4-(5-fluoropentan-2-yl)phenyl]-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | CC(CCCF)c1ccc(-c2ccc(O)c3c2C[C@H]2C[C@H]4[C@H](N(C)C)C(=O)C(C(N)=O)=C(O)[C@@]4(O)C(=O)C2=C3O)cc1 |
| InChI | InChI=1S/C32H35FN2O7/c1-15(5-4-12-33)16-6-8-17(9-7-16)19-10-11-22(36)24-20(19)13-18-14-21-26(35(2)3)28(38)25(31(34)41)30(40)32(21,42)29(39)23(18)27(24)37/h6-11,15,18,21,26,36-37,40,42H,4-5,12-14H2,1-3H3,(H2,34,41)/t15?,18-,21-,26-,32-/m0/s1 |
| InChIKey | HYJRLDOQHBPVMY-ZBDBCURUSA-N |
| XLogP | 3.48 |
| TPSA | 161.39 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.64 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|