C32H36FN3O7 — CID 54680912
(4S,12aR)-4-(dimethylamino)-7-[4-fluoro-3-[[methyl(propan-2-yl)amino]methyl]phenyl]-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 54680912) has the molecular formula C32H36FN3O7 and a molecular weight of 593.65 g/mol. Its IUPAC name is (4S,12aR)-4-(dimethylamino)-7-[4-fluoro-3-[[methyl(propan-2-yl)amino]methyl]phenyl]-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4S,12aR)-4-(dimethylamino)-7-[4-fluoro-3-[[methyl(propan-2-yl)amino]methyl]phenyl]-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 54680912 |
| Molecular Formula | C32H36FN3O7 |
| Molecular Weight | 593.65 g/mol |
| Exact Mass | 593.25 |
| IUPAC Name | (4S,12aR)-4-(dimethylamino)-7-[4-fluoro-3-[[methyl(propan-2-yl)amino]methyl]phenyl]-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | CC(C)N(C)Cc1cc(-c2ccc(O)c3c2CC2CC4[C@H](N(C)C)C(=O)C(C(N)=O)=C(O)[C@@]4(O)C(=O)C2=C3O)ccc1F |
| InChI | InChI=1S/C32H36FN3O7/c1-14(2)36(5)13-17-10-15(6-8-21(17)33)18-7-9-22(37)24-19(18)11-16-12-20-26(35(3)4)28(39)25(31(34)42)30(41)32(20,43)29(40)23(16)27(24)38/h6-10,14,16,20,26,37-38,41,43H,11-13H2,1-5H3,(H2,34,42)/t16?,20?,26-,32-/m0/s1 |
| InChIKey | SJDNWBNCPBTNTA-HILKCMEFSA-N |
| XLogP | 2.61 |
| TPSA | 164.63 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.65 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|