C28H25FN2O8 — CID 54692012
4-(dimethylamino)-7-(4-fluoro-3-formylphenyl)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 54692012) has the molecular formula C28H25FN2O8 and a molecular weight of 536.51 g/mol. Its IUPAC name is 4-(dimethylamino)-7-(4-fluoro-3-formylphenyl)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | 4-(dimethylamino)-7-(4-fluoro-3-formylphenyl)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 54692012 |
| Molecular Formula | C28H25FN2O8 |
| Molecular Weight | 536.51 g/mol |
| Exact Mass | 536.16 |
| IUPAC Name | 4-(dimethylamino)-7-(4-fluoro-3-formylphenyl)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | CN(C)C1C(=O)C(C(N)=O)=C(O)C2(O)C(=O)C3=C(O)c4c(O)ccc(-c5ccc(F)c(C=O)c5)c4CC3CC12 |
| InChI | InChI=1S/C28H25FN2O8/c1-31(2)22-16-9-12-8-15-14(11-3-5-17(29)13(7-11)10-32)4-6-18(33)20(15)23(34)19(12)25(36)28(16,39)26(37)21(24(22)35)27(30)38/h3-7,10,12,16,22,33-34,37,39H,8-9H2,1-2H3,(H2,30,38) |
| InChIKey | NJVYNEYWEWPRBY-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 178.46 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.51 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|