C27H28ClN3O7 — CID 161407638
(4S,4aS,5aR,12aR)-7-(6-chloro-3-pyridinyl)-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide;methane (PubChem CID 161407638) has the molecular formula C27H28ClN3O7 and a molecular weight of 541.99 g/mol. Its IUPAC name is (4S,4aS,5aR,12aR)-7-(6-chloro-3-pyridinyl)-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide;methane.
| Compound Name | (4S,4aS,5aR,12aR)-7-(6-chloro-3-pyridinyl)-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide;methane |
|---|---|
| PubChem CID | 161407638 |
| Molecular Formula | C27H28ClN3O7 |
| Molecular Weight | 541.99 g/mol |
| Exact Mass | 541.16 |
| IUPAC Name | (4S,4aS,5aR,12aR)-7-(6-chloro-3-pyridinyl)-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide;methane |
| SMILES | C.CN(C)[C@@H]1C(=O)C(C(N)=O)=C(O)[C@@]2(O)C(=O)C3=C(O)c4c(O)ccc(-c5ccc(Cl)nc5)c4C[C@H]3C[C@@H]12 |
| InChI | InChI=1S/C26H24ClN3O7.CH4/c1-30(2)20-14-8-11-7-13-12(10-3-6-16(27)29-9-10)4-5-15(31)18(13)21(32)17(11)23(34)26(14,37)24(35)19(22(20)33)25(28)36;/h3-6,9,11,14,20,31-32,35,37H,7-8H2,1-2H3,(H2,28,36);1H4/t11-,14-,20-,26-;/m0./s1 |
| InChIKey | GTRJWUZNEAEATP-LUBDNAQFSA-N |
| XLogP | 2.32 |
| TPSA | 174.28 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.99 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|