C26H24ClN3O7 — CID 137012641
7-(3-chloro-4-pyridinyl)-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 137012641) has the molecular formula C26H24ClN3O7 and a molecular weight of 525.95 g/mol. Its IUPAC name is 7-(3-chloro-4-pyridinyl)-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | 7-(3-chloro-4-pyridinyl)-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 137012641 |
| Molecular Formula | C26H24ClN3O7 |
| Molecular Weight | 525.95 g/mol |
| Exact Mass | 525.13 |
| IUPAC Name | 7-(3-chloro-4-pyridinyl)-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | CN(C)C1C(=O)C(C(N)=O)=C(O)C2(O)C(=O)C3=C(O)c4c(O)ccc(-c5ccncc5Cl)c4CC3CC12 |
| InChI | InChI=1S/C26H24ClN3O7/c1-30(2)20-14-8-10-7-13-11(12-5-6-29-9-15(12)27)3-4-16(31)18(13)21(32)17(10)23(34)26(14,37)24(35)19(22(20)33)25(28)36/h3-6,9-10,14,20,31-32,35,37H,7-8H2,1-2H3,(H2,28,36) |
| InChIKey | LFTCWZJQDILGAN-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 174.28 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.95 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|