C32H36N4O7 — CID 126545717
(4R,4aS,5aR,12aR)-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-7-[4-[(1-methylpyrrolidin-2-yl)amino]phenyl]-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 126545717) has the molecular formula C32H36N4O7 and a molecular weight of 588.66 g/mol. Its IUPAC name is (4R,4aS,5aR,12aR)-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-7-[4-[(1-methylpyrrolidin-2-yl)amino]phenyl]-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4R,4aS,5aR,12aR)-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-7-[4-[(1-methylpyrrolidin-2-yl)amino]phenyl]-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 126545717 |
| Molecular Formula | C32H36N4O7 |
| Molecular Weight | 588.66 g/mol |
| Exact Mass | 588.26 |
| IUPAC Name | (4R,4aS,5aR,12aR)-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-7-[4-[(1-methylpyrrolidin-2-yl)amino]phenyl]-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | CN1CCCC1Nc1ccc(-c2ccc(O)c3c2C[C@H]2C[C@H]4[C@@H](N(C)C)C(=O)C(C(N)=O)=C(O)[C@@]4(O)C(=O)C2=C3O)cc1 |
| InChI | InChI=1S/C32H36N4O7/c1-35(2)26-20-14-16-13-19-18(15-6-8-17(9-7-15)34-22-5-4-12-36(22)3)10-11-21(37)24(19)27(38)23(16)29(40)32(20,43)30(41)25(28(26)39)31(33)42/h6-11,16,20,22,26,34,37-38,41,43H,4-5,12-14H2,1-3H3,(H2,33,42)/t16-,20-,22?,26+,32-/m0/s1 |
| InChIKey | CXDWERPADUQEIN-WTAMYJEHSA-N |
| XLogP | 2.09 |
| TPSA | 176.66 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.66 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|