C31H33N3O10 — CID 54691890
2-methoxyethyl N-[4-[8-carbamoyl-10-(dimethylamino)-4,5,6a,7-tetrahydroxy-6,9-dioxo-10a,11,11a,12-tetrahydro-10H-tetracen-1-yl]phenyl]carbamate (PubChem CID 54691890) has the molecular formula C31H33N3O10 and a molecular weight of 607.62 g/mol. Its IUPAC name is 2-methoxyethyl N-[4-[8-carbamoyl-10-(dimethylamino)-4,5,6a,7-tetrahydroxy-6,9-dioxo-10a,11,11a,12-tetrahydro-10H-tetracen-1-yl]phenyl]carbamate.
| Compound Name | 2-methoxyethyl N-[4-[8-carbamoyl-10-(dimethylamino)-4,5,6a,7-tetrahydroxy-6,9-dioxo-10a,11,11a,12-tetrahydro-10H-tetracen-1-yl]phenyl]carbamate |
|---|---|
| PubChem CID | 54691890 |
| Molecular Formula | C31H33N3O10 |
| Molecular Weight | 607.62 g/mol |
| Exact Mass | 607.22 |
| IUPAC Name | 2-methoxyethyl N-[4-[8-carbamoyl-10-(dimethylamino)-4,5,6a,7-tetrahydroxy-6,9-dioxo-10a,11,11a,12-tetrahydro-10H-tetracen-1-yl]phenyl]carbamate |
| SMILES | COCCOC(=O)Nc1ccc(-c2ccc(O)c3c2CC2CC4C(N(C)C)C(=O)C(C(N)=O)=C(O)C4(O)C(=O)C2=C3O)cc1 |
| InChI | InChI=1S/C31H33N3O10/c1-34(2)24-19-13-15-12-18-17(14-4-6-16(7-5-14)33-30(41)44-11-10-43-3)8-9-20(35)22(18)25(36)21(15)27(38)31(19,42)28(39)23(26(24)37)29(32)40/h4-9,15,19,24,35-36,39,42H,10-13H2,1-3H3,(H2,32,40)(H,33,41) |
| InChIKey | XPFWRSSKZJAFIO-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 208.95 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.62 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|