C25H32N4O8 — CID 59046872
(4S,12aR)-4-(dimethylamino)-7-[[2-(dimethylamino)acetyl]amino]-3,10,11,12a-tetrahydroxy-1,12-dioxo-3,4,4a,5,5a,6-hexahydro-2H-tetracene-2-carboxamide (PubChem CID 59046872) has the molecular formula C25H32N4O8 and a molecular weight of 516.55 g/mol. Its IUPAC name is (4S,12aR)-4-(dimethylamino)-7-[[2-(dimethylamino)acetyl]amino]-3,10,11,12a-tetrahydroxy-1,12-dioxo-3,4,4a,5,5a,6-hexahydro-2H-tetracene-2-carboxamide.
| Compound Name | (4S,12aR)-4-(dimethylamino)-7-[[2-(dimethylamino)acetyl]amino]-3,10,11,12a-tetrahydroxy-1,12-dioxo-3,4,4a,5,5a,6-hexahydro-2H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 59046872 |
| Molecular Formula | C25H32N4O8 |
| Molecular Weight | 516.55 g/mol |
| Exact Mass | 516.22 |
| IUPAC Name | (4S,12aR)-4-(dimethylamino)-7-[[2-(dimethylamino)acetyl]amino]-3,10,11,12a-tetrahydroxy-1,12-dioxo-3,4,4a,5,5a,6-hexahydro-2H-tetracene-2-carboxamide |
| SMILES | CN(C)CC(=O)Nc1ccc(O)c2c1CC1CC3[C@H](N(C)C)C(O)C(C(N)=O)C(=O)[C@@]3(O)C(=O)C1=C2O |
| InChI | InChI=1S/C25H32N4O8/c1-28(2)9-15(31)27-13-5-6-14(30)17-11(13)7-10-8-12-19(29(3)4)21(33)18(24(26)36)23(35)25(12,37)22(34)16(10)20(17)32/h5-6,10,12,18-19,21,30,32-33,37H,7-9H2,1-4H3,(H2,26,36)(H,27,31)/t10?,12?,18?,19-,21?,25-/m0/s1 |
| InChIKey | NQCBJQBPZHXGOY-ACSGKNRASA-N |
| XLogP | -1.37 |
| TPSA | 193.73 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.55 |
| LogP ≤ 5 | -1.37 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|