C23H23IN2O8 — CID 54719194
7-acetyl-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-9-iodo-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 54719194) has the molecular formula C23H23IN2O8 and a molecular weight of 582.35 g/mol. Its IUPAC name is 7-acetyl-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-9-iodo-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | 7-acetyl-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-9-iodo-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 54719194 |
| Molecular Formula | C23H23IN2O8 |
| Molecular Weight | 582.35 g/mol |
| Exact Mass | 582.05 |
| IUPAC Name | 7-acetyl-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-9-iodo-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | CC(=O)c1cc(I)c(O)c2c1CC1CC3C(N(C)C)C(=O)C(C(N)=O)=C(O)C3(O)C(=O)C1=C2O |
| InChI | InChI=1S/C23H23IN2O8/c1-7(27)9-6-12(24)17(28)14-10(9)4-8-5-11-16(26(2)3)19(30)15(22(25)33)21(32)23(11,34)20(31)13(8)18(14)29/h6,8,11,16,28-29,32,34H,4-5H2,1-3H3,(H2,25,33) |
| InChIKey | CGCGETUZJJAHKR-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 178.46 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.35 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|