C21H24IN3O11S — CID 67766791
(4S)-7-amino-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-9-iodo-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide;sulfuric acid (PubChem CID 67766791) has the molecular formula C21H24IN3O11S and a molecular weight of 653.40 g/mol. Its IUPAC name is (4S)-7-amino-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-9-iodo-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide;sulfuric acid.
| Compound Name | (4S)-7-amino-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-9-iodo-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide;sulfuric acid |
|---|---|
| PubChem CID | 67766791 |
| Molecular Formula | C21H24IN3O11S |
| Molecular Weight | 653.40 g/mol |
| Exact Mass | 653.02 |
| IUPAC Name | (4S)-7-amino-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-9-iodo-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide;sulfuric acid |
| SMILES | CN(C)[C@@H]1C(=O)C(C(N)=O)=C(O)C2(O)C(=O)C3=C(O)c4c(O)c(I)cc(N)c4CC3CC12.O=S(=O)(O)O |
| InChI | InChI=1S/C21H22IN3O7.H2O4S/c1-25(2)14-8-4-6-3-7-10(23)5-9(22)15(26)12(7)16(27)11(6)18(29)21(8,32)19(30)13(17(14)28)20(24)31;1-5(2,3)4/h5-6,8,14,26-27,30,32H,3-4,23H2,1-2H3,(H2,24,31);(H2,1,2,3,4)/t6?,8?,14-,21?;/m0./s1 |
| InChIKey | XQBZWAWFCOJKKM-MXNPQFBDSA-N |
| XLogP | -0.50 |
| TPSA | 262.01 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.40 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|