C20H21FN4O7 — CID 54730311
(6aR,10S,10aS,11aR)-3-amino-10-(dimethylamino)-1-fluoro-4,5,6a,7-tetrahydroxy-6,9-dioxo-10a,11,11a,12-tetrahydro-10H-naphtho[3,2-g]isoquinoline-8-carboxamide (PubChem CID 54730311) has the molecular formula C20H21FN4O7 and a molecular weight of 448.41 g/mol. Its IUPAC name is (6aR,10S,10aS,11aR)-3-amino-10-(dimethylamino)-1-fluoro-4,5,6a,7-tetrahydroxy-6,9-dioxo-10a,11,11a,12-tetrahydro-10H-naphtho[3,2-g]isoquinoline-8-carboxamide.
| Compound Name | (6aR,10S,10aS,11aR)-3-amino-10-(dimethylamino)-1-fluoro-4,5,6a,7-tetrahydroxy-6,9-dioxo-10a,11,11a,12-tetrahydro-10H-naphtho[3,2-g]isoquinoline-8-carboxamide |
|---|---|
| PubChem CID | 54730311 |
| Molecular Formula | C20H21FN4O7 |
| Molecular Weight | 448.41 g/mol |
| Exact Mass | 448.14 |
| IUPAC Name | (6aR,10S,10aS,11aR)-3-amino-10-(dimethylamino)-1-fluoro-4,5,6a,7-tetrahydroxy-6,9-dioxo-10a,11,11a,12-tetrahydro-10H-naphtho[3,2-g]isoquinoline-8-carboxamide |
| SMILES | CN(C)[C@@H]1C(=O)C(C(N)=O)=C(O)[C@@]2(O)C(=O)C3=C(O)c4c(O)c(N)nc(F)c4C[C@H]3C[C@@H]12 |
| InChI | InChI=1S/C20H21FN4O7/c1-25(2)11-7-4-5-3-6-9(14(28)18(22)24-17(6)21)12(26)8(5)15(29)20(7,32)16(30)10(13(11)27)19(23)31/h5,7,11,26,28,30,32H,3-4H2,1-2H3,(H2,22,24)(H2,23,31)/t5-,7-,11-,20-/m0/s1 |
| InChIKey | XEDNDYWWXGGLCG-NKUNFYDOSA-N |
| XLogP | -0.92 |
| TPSA | 200.30 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.41 |
| LogP ≤ 5 | -0.92 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|