C24H29ClN4O7 — CID 54730294
(6aR,10S,10aS,11aR)-1-chloro-10-(dimethylamino)-4,5,6a,7-tetrahydroxy-3-(2-methylpropylamino)-6,9-dioxo-10a,11,11a,12-tetrahydro-10H-naphtho[3,2-g]isoquinoline-8-carboxamide (PubChem CID 54730294) has the molecular formula C24H29ClN4O7 and a molecular weight of 520.97 g/mol. Its IUPAC name is (6aR,10S,10aS,11aR)-1-chloro-10-(dimethylamino)-4,5,6a,7-tetrahydroxy-3-(2-methylpropylamino)-6,9-dioxo-10a,11,11a,12-tetrahydro-10H-naphtho[3,2-g]isoquinoline-8-carboxamide.
| Compound Name | (6aR,10S,10aS,11aR)-1-chloro-10-(dimethylamino)-4,5,6a,7-tetrahydroxy-3-(2-methylpropylamino)-6,9-dioxo-10a,11,11a,12-tetrahydro-10H-naphtho[3,2-g]isoquinoline-8-carboxamide |
|---|---|
| PubChem CID | 54730294 |
| Molecular Formula | C24H29ClN4O7 |
| Molecular Weight | 520.97 g/mol |
| Exact Mass | 520.17 |
| IUPAC Name | (6aR,10S,10aS,11aR)-1-chloro-10-(dimethylamino)-4,5,6a,7-tetrahydroxy-3-(2-methylpropylamino)-6,9-dioxo-10a,11,11a,12-tetrahydro-10H-naphtho[3,2-g]isoquinoline-8-carboxamide |
| SMILES | CC(C)CNc1nc(Cl)c2c(c1O)C(O)=C1C(=O)[C@]3(O)C(O)=C(C(N)=O)C(=O)[C@@H](N(C)C)[C@@H]3C[C@@H]1C2 |
| InChI | InChI=1S/C24H29ClN4O7/c1-8(2)7-27-23-18(32)13-10(21(25)28-23)5-9-6-11-15(29(3)4)17(31)14(22(26)35)20(34)24(11,36)19(33)12(9)16(13)30/h8-9,11,15,30,32,34,36H,5-7H2,1-4H3,(H2,26,35)(H,27,28)/t9-,11-,15-,24-/m0/s1 |
| InChIKey | RJYAGDIHGXJIRM-FBUVNXAESA-N |
| XLogP | 1.08 |
| TPSA | 186.31 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.97 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|