C27H33ClN2O7 — CID 140505568
(4S,4aS,5aR,12aR)-9-tert-butyl-7-(1-chloroethyl)-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 140505568) has the molecular formula C27H33ClN2O7 and a molecular weight of 533.02 g/mol. Its IUPAC name is (4S,4aS,5aR,12aR)-9-tert-butyl-7-(1-chloroethyl)-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4S,4aS,5aR,12aR)-9-tert-butyl-7-(1-chloroethyl)-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 140505568 |
| Molecular Formula | C27H33ClN2O7 |
| Molecular Weight | 533.02 g/mol |
| Exact Mass | 532.20 |
| IUPAC Name | (4S,4aS,5aR,12aR)-9-tert-butyl-7-(1-chloroethyl)-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | CC(Cl)c1cc(C(C)(C)C)c(O)c2c1C[C@H]1C[C@H]3[C@H](N(C)C)C(=O)C(C(N)=O)=C(O)[C@@]3(O)C(=O)C1=C2O |
| InChI | InChI=1S/C27H33ClN2O7/c1-10(28)12-9-15(26(2,3)4)20(31)17-13(12)7-11-8-14-19(30(5)6)22(33)18(25(29)36)24(35)27(14,37)23(34)16(11)21(17)32/h9-11,14,19,31-32,35,37H,7-8H2,1-6H3,(H2,29,36)/t10?,11-,14-,19-,27-/m0/s1 |
| InChIKey | LMRGBQCPINCRPO-QVKIJMFISA-N |
| XLogP | 2.56 |
| TPSA | 161.39 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.02 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|