C29H37N3O8 — CID 140505994
(4S,4aS,5aR,12aR)-4-(dimethylamino)-7-ethyl-1,10,11,12a-tetrahydroxy-9-[(3-methylbutanoylamino)methyl]-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 140505994) has the molecular formula C29H37N3O8 and a molecular weight of 555.63 g/mol. Its IUPAC name is (4S,4aS,5aR,12aR)-4-(dimethylamino)-7-ethyl-1,10,11,12a-tetrahydroxy-9-[(3-methylbutanoylamino)methyl]-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4S,4aS,5aR,12aR)-4-(dimethylamino)-7-ethyl-1,10,11,12a-tetrahydroxy-9-[(3-methylbutanoylamino)methyl]-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 140505994 |
| Molecular Formula | C29H37N3O8 |
| Molecular Weight | 555.63 g/mol |
| Exact Mass | 555.26 |
| IUPAC Name | (4S,4aS,5aR,12aR)-4-(dimethylamino)-7-ethyl-1,10,11,12a-tetrahydroxy-9-[(3-methylbutanoylamino)methyl]-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | CCc1cc(CNC(=O)CC(C)C)c(O)c2c1C[C@H]1C[C@H]3[C@H](N(C)C)C(=O)C(C(N)=O)=C(O)[C@@]3(O)C(=O)C1=C2O |
| InChI | InChI=1S/C29H37N3O8/c1-6-13-8-15(11-31-18(33)7-12(2)3)23(34)20-16(13)9-14-10-17-22(32(4)5)25(36)21(28(30)39)27(38)29(17,40)26(37)19(14)24(20)35/h8,12,14,17,22,34-35,38,40H,6-7,9-11H2,1-5H3,(H2,30,39)(H,31,33)/t14-,17-,22-,29-/m0/s1 |
| InChIKey | PVCVVGWZGLCCJT-APUYUXPVSA-N |
| XLogP | 1.19 |
| TPSA | 190.49 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.63 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|