C23H28ClFN4O7 — CID 67602756
9-amino-4,7-bis(dimethylamino)-8-fluoro-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide;hydrochloride (PubChem CID 67602756) has the molecular formula C23H28ClFN4O7 and a molecular weight of 526.95 g/mol. Its IUPAC name is 9-amino-4,7-bis(dimethylamino)-8-fluoro-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide;hydrochloride.
| Compound Name | 9-amino-4,7-bis(dimethylamino)-8-fluoro-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 67602756 |
| Molecular Formula | C23H28ClFN4O7 |
| Molecular Weight | 526.95 g/mol |
| Exact Mass | 526.16 |
| IUPAC Name | 9-amino-4,7-bis(dimethylamino)-8-fluoro-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide;hydrochloride |
| SMILES | CN(C)c1c(F)c(N)c(O)c2c1CC1CC3C(N(C)C)C(=O)C(C(N)=O)=C(O)C3(O)C(=O)C1=C2O.Cl |
| InChI | InChI=1S/C23H27FN4O7.ClH/c1-27(2)15-8-5-7-6-9-16(28(3)4)19(31)12(22(26)34)21(33)23(9,35)20(32)10(7)17(29)11(8)18(30)14(25)13(15)24;/h7,9,16,29-30,33,35H,5-6,25H2,1-4H3,(H2,26,34);1H |
| InChIKey | HZNWFFJZGLTZKA-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 190.65 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.95 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|