C21H23Cl2N3O7 — CID 70205821
9-amino-8-chloro-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide;hydrochloride (PubChem CID 70205821) has the molecular formula C21H23Cl2N3O7 and a molecular weight of 500.34 g/mol. Its IUPAC name is 9-amino-8-chloro-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide;hydrochloride.
| Compound Name | 9-amino-8-chloro-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 70205821 |
| Molecular Formula | C21H23Cl2N3O7 |
| Molecular Weight | 500.34 g/mol |
| Exact Mass | 499.09 |
| IUPAC Name | 9-amino-8-chloro-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide;hydrochloride |
| SMILES | CN(C)C1C(=O)C(C(N)=O)=C(O)C2(O)C(=O)C3=C(O)c4c(cc(Cl)c(N)c4O)CC3CC12.Cl |
| InChI | InChI=1S/C21H22ClN3O7.ClH/c1-25(2)14-8-4-6-3-7-5-9(22)13(23)16(27)10(7)15(26)11(6)18(29)21(8,32)19(30)12(17(14)28)20(24)31;/h5-6,8,14,26-27,30,32H,3-4,23H2,1-2H3,(H2,24,31);1H |
| InChIKey | HDZCJECKBCFQPF-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 187.41 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.34 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|