C21H22ClFN2O7 — CID 67602025
4-(dimethylamino)-8-fluoro-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide;hydrochloride (PubChem CID 67602025) has the molecular formula C21H22ClFN2O7 and a molecular weight of 468.87 g/mol. Its IUPAC name is 4-(dimethylamino)-8-fluoro-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide;hydrochloride.
| Compound Name | 4-(dimethylamino)-8-fluoro-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 67602025 |
| Molecular Formula | C21H22ClFN2O7 |
| Molecular Weight | 468.87 g/mol |
| Exact Mass | 468.11 |
| IUPAC Name | 4-(dimethylamino)-8-fluoro-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide;hydrochloride |
| SMILES | CN(C)C1C(=O)C(C(N)=O)=C(O)C2(O)C(=O)C3=C(O)c4c(O)cc(F)cc4CC3CC12.Cl |
| InChI | InChI=1S/C21H21FN2O7.ClH/c1-24(2)15-10-5-8-3-7-4-9(22)6-11(25)12(7)16(26)13(8)18(28)21(10,31)19(29)14(17(15)27)20(23)30;/h4,6,8,10,15,25-26,29,31H,3,5H2,1-2H3,(H2,23,30);1H |
| InChIKey | RKTYLRXQGGYOPX-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 161.39 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.87 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|