C22H26N4O7 — CID 126585952
(4S,4aS,5aR,12aR)-8-[amino(methyl)amino]-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 126585952) has the molecular formula C22H26N4O7 and a molecular weight of 458.47 g/mol. Its IUPAC name is (4S,4aS,5aR,12aR)-8-[amino(methyl)amino]-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4S,4aS,5aR,12aR)-8-[amino(methyl)amino]-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 126585952 |
| Molecular Formula | C22H26N4O7 |
| Molecular Weight | 458.47 g/mol |
| Exact Mass | 458.18 |
| IUPAC Name | (4S,4aS,5aR,12aR)-8-[amino(methyl)amino]-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | CN(N)c1cc(O)c2c(c1)C[C@H]1C[C@H]3[C@H](N(C)C)C(=O)C(C(N)=O)=C(O)[C@@]3(O)C(=O)C1=C2O |
| InChI | InChI=1S/C22H26N4O7/c1-25(2)16-11-6-9-4-8-5-10(26(3)24)7-12(27)13(8)17(28)14(9)19(30)22(11,33)20(31)15(18(16)29)21(23)32/h5,7,9,11,16,27-28,31,33H,4,6,24H2,1-3H3,(H2,23,32)/t9-,11-,16-,22-/m0/s1 |
| InChIKey | PJKIXLXHYLVZKO-YFXODTNBSA-N |
| XLogP | -0.73 |
| TPSA | 190.65 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.47 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|