C25H31ClN4O7 — CID 70138478
(4S,12aR)-9-amino-8-chloro-7-(diethylamino)-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 70138478) has the molecular formula C25H31ClN4O7 and a molecular weight of 535.00 g/mol. Its IUPAC name is (4S,12aR)-9-amino-8-chloro-7-(diethylamino)-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4S,12aR)-9-amino-8-chloro-7-(diethylamino)-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 70138478 |
| Molecular Formula | C25H31ClN4O7 |
| Molecular Weight | 535.00 g/mol |
| Exact Mass | 534.19 |
| IUPAC Name | (4S,12aR)-9-amino-8-chloro-7-(diethylamino)-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | CCN(CC)c1c(Cl)c(N)c(O)c2c1CC1CC3[C@H](N(C)C)C(=O)C(C(N)=O)=C(O)[C@@]3(O)C(=O)C1=C2O |
| InChI | InChI=1S/C25H31ClN4O7/c1-5-30(6-2)17-10-7-9-8-11-18(29(3)4)21(33)14(24(28)36)23(35)25(11,37)22(34)12(9)19(31)13(10)20(32)16(27)15(17)26/h9,11,18,31-32,35,37H,5-8,27H2,1-4H3,(H2,28,36)/t9?,11?,18-,25-/m0/s1 |
| InChIKey | WBLKWEHOUOWINB-MQSWWYIRSA-N |
| XLogP | 1.05 |
| TPSA | 190.65 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.00 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|