C26H36N4O11S — CID 67782679
(4S,12aR)-9-amino-4-(dimethylamino)-7-[ethyl(propyl)amino]-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide;sulfuric acid (PubChem CID 67782679) has the molecular formula C26H36N4O11S and a molecular weight of 612.66 g/mol. Its IUPAC name is (4S,12aR)-9-amino-4-(dimethylamino)-7-[ethyl(propyl)amino]-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide;sulfuric acid.
| Compound Name | (4S,12aR)-9-amino-4-(dimethylamino)-7-[ethyl(propyl)amino]-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide;sulfuric acid |
|---|---|
| PubChem CID | 67782679 |
| Molecular Formula | C26H36N4O11S |
| Molecular Weight | 612.66 g/mol |
| Exact Mass | 612.21 |
| IUPAC Name | (4S,12aR)-9-amino-4-(dimethylamino)-7-[ethyl(propyl)amino]-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide;sulfuric acid |
| SMILES | CCCN(CC)c1cc(N)c(O)c2c1CC1CC3[C@H](N(C)C)C(=O)C(C(N)=O)=C(O)[C@@]3(O)C(=O)C1=C2O.O=S(=O)(O)O |
| InChI | InChI=1S/C26H34N4O7.H2O4S/c1-5-7-30(6-2)15-10-14(27)20(31)17-12(15)8-11-9-13-19(29(3)4)22(33)18(25(28)36)24(35)26(13,37)23(34)16(11)21(17)32;1-5(2,3)4/h10-11,13,19,31-32,35,37H,5-9,27H2,1-4H3,(H2,28,36);(H2,1,2,3,4)/t11?,13?,19-,26-;/m0./s1 |
| InChIKey | QNPZQYPESBJFMU-NKUVIKHNSA-N |
| XLogP | 0.13 |
| TPSA | 265.25 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.66 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|