C28H40N4O11S — CID 67782854
(4S,12aR)-9-amino-7-[butan-2-yl(propan-2-yl)amino]-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide;sulfuric acid (PubChem CID 67782854) has the molecular formula C28H40N4O11S and a molecular weight of 640.71 g/mol. Its IUPAC name is (4S,12aR)-9-amino-7-[butan-2-yl(propan-2-yl)amino]-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide;sulfuric acid.
| Compound Name | (4S,12aR)-9-amino-7-[butan-2-yl(propan-2-yl)amino]-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide;sulfuric acid |
|---|---|
| PubChem CID | 67782854 |
| Molecular Formula | C28H40N4O11S |
| Molecular Weight | 640.71 g/mol |
| Exact Mass | 640.24 |
| IUPAC Name | (4S,12aR)-9-amino-7-[butan-2-yl(propan-2-yl)amino]-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide;sulfuric acid |
| SMILES | CCC(C)N(c1cc(N)c(O)c2c1CC1CC3[C@H](N(C)C)C(=O)C(C(N)=O)=C(O)[C@@]3(O)C(=O)C1=C2O)C(C)C.O=S(=O)(O)O |
| InChI | InChI=1S/C28H38N4O7.H2O4S/c1-7-12(4)32(11(2)3)17-10-16(29)22(33)19-14(17)8-13-9-15-21(31(5)6)24(35)20(27(30)38)26(37)28(15,39)25(36)18(13)23(19)34;1-5(2,3)4/h10-13,15,21,33-34,37,39H,7-9,29H2,1-6H3,(H2,30,38);(H2,1,2,3,4)/t12?,13?,15?,21-,28-;/m0./s1 |
| InChIKey | PVGTWYQJPIUXNQ-ZDRINDGKSA-N |
| XLogP | 0.91 |
| TPSA | 265.25 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.71 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|