C29H40N4O7 — CID 67782951
(4S,12aR)-9-amino-7-[butyl(2-methylpropyl)amino]-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 67782951) has the molecular formula C29H40N4O7 and a molecular weight of 556.66 g/mol. Its IUPAC name is (4S,12aR)-9-amino-7-[butyl(2-methylpropyl)amino]-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4S,12aR)-9-amino-7-[butyl(2-methylpropyl)amino]-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 67782951 |
| Molecular Formula | C29H40N4O7 |
| Molecular Weight | 556.66 g/mol |
| Exact Mass | 556.29 |
| IUPAC Name | (4S,12aR)-9-amino-7-[butyl(2-methylpropyl)amino]-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | CCCCN(CC(C)C)c1cc(N)c(O)c2c1CC1CC3[C@H](N(C)C)C(=O)C(C(N)=O)=C(O)[C@@]3(O)C(=O)C1=C2O |
| InChI | InChI=1S/C29H40N4O7/c1-6-7-8-33(12-13(2)3)18-11-17(30)23(34)20-15(18)9-14-10-16-22(32(4)5)25(36)21(28(31)39)27(38)29(16,40)26(37)19(14)24(20)35/h11,13-14,16,22,34-35,38,40H,6-10,12,30H2,1-5H3,(H2,31,39)/t14?,16?,22-,29-/m0/s1 |
| InChIKey | PSKRGAZICQKZKK-LMNISFGMSA-N |
| XLogP | 1.81 |
| TPSA | 190.65 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.66 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|