C23H30N4O11S — CID 67783320
(4S)-9-amino-4-(dimethylamino)-7-(ethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide;sulfuric acid (PubChem CID 67783320) has the molecular formula C23H30N4O11S and a molecular weight of 570.58 g/mol. Its IUPAC name is (4S)-9-amino-4-(dimethylamino)-7-(ethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide;sulfuric acid.
| Compound Name | (4S)-9-amino-4-(dimethylamino)-7-(ethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide;sulfuric acid |
|---|---|
| PubChem CID | 67783320 |
| Molecular Formula | C23H30N4O11S |
| Molecular Weight | 570.58 g/mol |
| Exact Mass | 570.16 |
| IUPAC Name | (4S)-9-amino-4-(dimethylamino)-7-(ethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide;sulfuric acid |
| SMILES | CCNc1cc(N)c(O)c2c1CC1CC3[C@H](N(C)C)C(=O)C(C(N)=O)=C(O)C3(O)C(=O)C1=C2O.O=S(=O)(O)O |
| InChI | InChI=1S/C23H28N4O7.H2O4S/c1-4-26-12-7-11(24)17(28)14-9(12)5-8-6-10-16(27(2)3)19(30)15(22(25)33)21(32)23(10,34)20(31)13(8)18(14)29;1-5(2,3)4/h7-8,10,16,26,28-29,32,34H,4-6,24H2,1-3H3,(H2,25,33);(H2,1,2,3,4)/t8?,10?,16-,23?;/m0./s1 |
| InChIKey | JVOZMQXLNZHTLV-NWXYMQOASA-N |
| XLogP | -0.67 |
| TPSA | 274.04 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.58 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|