C25H32N4O13S — CID 67782673
(4S,12aR)-7-(butylamino)-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-9-nitro-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide;sulfuric acid (PubChem CID 67782673) has the molecular formula C25H32N4O13S and a molecular weight of 628.61 g/mol. Its IUPAC name is (4S,12aR)-7-(butylamino)-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-9-nitro-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide;sulfuric acid.
| Compound Name | (4S,12aR)-7-(butylamino)-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-9-nitro-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide;sulfuric acid |
|---|---|
| PubChem CID | 67782673 |
| Molecular Formula | C25H32N4O13S |
| Molecular Weight | 628.61 g/mol |
| Exact Mass | 628.17 |
| IUPAC Name | (4S,12aR)-7-(butylamino)-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-9-nitro-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide;sulfuric acid |
| SMILES | CCCCNc1cc([N+](=O)[O-])c(O)c2c1CC1CC3[C@H](N(C)C)C(=O)C(C(N)=O)=C(O)[C@@]3(O)C(=O)C1=C2O.O=S(=O)(O)O |
| InChI | InChI=1S/C25H30N4O9.H2O4S/c1-4-5-6-27-13-9-14(29(37)38)19(30)16-11(13)7-10-8-12-18(28(2)3)21(32)17(24(26)35)23(34)25(12,36)22(33)15(10)20(16)31;1-5(2,3)4/h9-10,12,18,27,30-31,34,36H,4-8H2,1-3H3,(H2,26,35);(H2,1,2,3,4)/t10?,12?,18-,25-;/m0./s1 |
| InChIKey | XUTOVIGKIATTAE-QPUAWESGSA-N |
| XLogP | 0.43 |
| TPSA | 291.16 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.61 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|