C28H31N5O10 — CID 58632455
(4S,4aS,5aR,12aR)-4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-9-[(5-nitrofuran-2-yl)methylamino]-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 58632455) has the molecular formula C28H31N5O10 and a molecular weight of 597.58 g/mol. Its IUPAC name is (4S,4aS,5aR,12aR)-4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-9-[(5-nitrofuran-2-yl)methylamino]-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4S,4aS,5aR,12aR)-4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-9-[(5-nitrofuran-2-yl)methylamino]-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 58632455 |
| Molecular Formula | C28H31N5O10 |
| Molecular Weight | 597.58 g/mol |
| Exact Mass | 597.21 |
| IUPAC Name | (4S,4aS,5aR,12aR)-4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-9-[(5-nitrofuran-2-yl)methylamino]-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | CN(C)c1cc(NCc2ccc([N+](=O)[O-])o2)c(O)c2c1C[C@H]1C[C@H]3[C@H](N(C)C)C(=O)C(C(N)=O)=C(O)[C@@]3(O)C(=O)C1=C2O |
| InChI | InChI=1S/C28H31N5O10/c1-31(2)16-9-15(30-10-12-5-6-17(43-12)33(41)42)22(34)19-13(16)7-11-8-14-21(32(3)4)24(36)20(27(29)39)26(38)28(14,40)25(37)18(11)23(19)35/h5-6,9,11,14,21,30,34-35,38,40H,7-8,10H2,1-4H3,(H2,29,39)/t11-,14-,21-,28-/m0/s1 |
| InChIKey | MBBMFNLCHYBINH-VMTUJNLTSA-N |
| XLogP | 1.14 |
| TPSA | 232.94 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.58 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|