C29H38N4O9 — CID 67783201
(4S,12aR)-7-(dibutylamino)-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-9-nitro-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 67783201) has the molecular formula C29H38N4O9 and a molecular weight of 586.64 g/mol. Its IUPAC name is (4S,12aR)-7-(dibutylamino)-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-9-nitro-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4S,12aR)-7-(dibutylamino)-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-9-nitro-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 67783201 |
| Molecular Formula | C29H38N4O9 |
| Molecular Weight | 586.64 g/mol |
| Exact Mass | 586.26 |
| IUPAC Name | (4S,12aR)-7-(dibutylamino)-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-9-nitro-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | CCCCN(CCCC)c1cc([N+](=O)[O-])c(O)c2c1CC1CC3[C@H](N(C)C)C(=O)C(C(N)=O)=C(O)[C@@]3(O)C(=O)C1=C2O |
| InChI | InChI=1S/C29H38N4O9/c1-5-7-9-32(10-8-6-2)17-13-18(33(41)42)23(34)20-15(17)11-14-12-16-22(31(3)4)25(36)21(28(30)39)27(38)29(16,40)26(37)19(14)24(20)35/h13-14,16,22,34-35,38,40H,5-12H2,1-4H3,(H2,30,39)/t14?,16?,22-,29-/m0/s1 |
| InChIKey | KXVLMEUZKHRINY-LMNISFGMSA-N |
| XLogP | 2.28 |
| TPSA | 207.77 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.64 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|