C25H26FN3O7 — CID 54680251
4,7-bis(dimethylamino)-9-(2-fluoroethynyl)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 54680251) has the molecular formula C25H26FN3O7 and a molecular weight of 499.50 g/mol. Its IUPAC name is 4,7-bis(dimethylamino)-9-(2-fluoroethynyl)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | 4,7-bis(dimethylamino)-9-(2-fluoroethynyl)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 54680251 |
| Molecular Formula | C25H26FN3O7 |
| Molecular Weight | 499.50 g/mol |
| Exact Mass | 499.18 |
| IUPAC Name | 4,7-bis(dimethylamino)-9-(2-fluoroethynyl)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | CN(C)c1cc(C#CF)c(O)c2c1CC1CC3C(N(C)C)C(=O)C(C(N)=O)=C(O)C3(O)C(=O)C1=C2O |
| InChI | InChI=1S/C25H26FN3O7/c1-28(2)14-9-10(5-6-26)19(30)16-12(14)7-11-8-13-18(29(3)4)21(32)17(24(27)35)23(34)25(13,36)22(33)15(11)20(16)31/h9,11,13,18,30-31,34,36H,7-8H2,1-4H3,(H2,27,35) |
| InChIKey | UMFAXUZCDGYMMT-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 164.63 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.50 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|