C31H37N3O8 — CID 54681056
4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-9-[2-(1-hydroxycyclohexyl)ethynyl]-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 54681056) has the molecular formula C31H37N3O8 and a molecular weight of 579.65 g/mol. Its IUPAC name is 4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-9-[2-(1-hydroxycyclohexyl)ethynyl]-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | 4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-9-[2-(1-hydroxycyclohexyl)ethynyl]-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 54681056 |
| Molecular Formula | C31H37N3O8 |
| Molecular Weight | 579.65 g/mol |
| Exact Mass | 579.26 |
| IUPAC Name | 4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-9-[2-(1-hydroxycyclohexyl)ethynyl]-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | CN(C)c1cc(C#CC2(O)CCCCC2)c(O)c2c1CC1CC3C(N(C)C)C(=O)C(C(N)=O)=C(O)C3(O)C(=O)C1=C2O |
| InChI | InChI=1S/C31H37N3O8/c1-33(2)19-14-15(8-11-30(41)9-6-5-7-10-30)24(35)21-17(19)12-16-13-18-23(34(3)4)26(37)22(29(32)40)28(39)31(18,42)27(38)20(16)25(21)36/h14,16,18,23,35-36,39,41-42H,5-7,9-10,12-13H2,1-4H3,(H2,32,40) |
| InChIKey | YVGVOWVHLGZVLJ-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 184.86 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.65 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|