C28H31N3O7 — CID 54742650
(4S,4aS,5aR,14aR)-4,7-bis(dimethylamino)-1,13,14a-trihydroxy-12-methoxy-3,14-dioxo-4a,5,5a,6-tetrahydro-4H-pentacene-2-carboxamide (PubChem CID 54742650) has the molecular formula C28H31N3O7 and a molecular weight of 521.57 g/mol. Its IUPAC name is (4S,4aS,5aR,14aR)-4,7-bis(dimethylamino)-1,13,14a-trihydroxy-12-methoxy-3,14-dioxo-4a,5,5a,6-tetrahydro-4H-pentacene-2-carboxamide.
| Compound Name | (4S,4aS,5aR,14aR)-4,7-bis(dimethylamino)-1,13,14a-trihydroxy-12-methoxy-3,14-dioxo-4a,5,5a,6-tetrahydro-4H-pentacene-2-carboxamide |
|---|---|
| PubChem CID | 54742650 |
| Molecular Formula | C28H31N3O7 |
| Molecular Weight | 521.57 g/mol |
| Exact Mass | 521.22 |
| IUPAC Name | (4S,4aS,5aR,14aR)-4,7-bis(dimethylamino)-1,13,14a-trihydroxy-12-methoxy-3,14-dioxo-4a,5,5a,6-tetrahydro-4H-pentacene-2-carboxamide |
| SMILES | COc1c2c(c(N(C)C)c3ccccc13)C[C@H]1C[C@H]3[C@H](N(C)C)C(=O)C(C(N)=O)=C(O)[C@@]3(O)C(=O)C1=C2O |
| InChI | InChI=1S/C28H31N3O7/c1-30(2)20-13-8-6-7-9-14(13)24(38-5)18-15(20)10-12-11-16-21(31(3)4)23(33)19(27(29)36)26(35)28(16,37)25(34)17(12)22(18)32/h6-9,12,16,21,32,35,37H,10-11H2,1-5H3,(H2,29,36)/t12-,16-,21-,28-/m0/s1 |
| InChIKey | IDWPLJRDYKORKS-IVQLTOCRSA-N |
| XLogP | 1.49 |
| TPSA | 153.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.57 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|