C32H39N3O8 — CID 157237550
(4S,4aS,5aR,14aR)-4,7-bis(dimethylamino)-1,12,13,14a-tetrahydroxy-10-(5-hydroxypentyl)-3,14-dioxo-4a,5,5a,6-tetrahydro-4H-pentacene-2-carboxamide (PubChem CID 157237550) has the molecular formula C32H39N3O8 and a molecular weight of 593.68 g/mol. Its IUPAC name is (4S,4aS,5aR,14aR)-4,7-bis(dimethylamino)-1,12,13,14a-tetrahydroxy-10-(5-hydroxypentyl)-3,14-dioxo-4a,5,5a,6-tetrahydro-4H-pentacene-2-carboxamide.
| Compound Name | (4S,4aS,5aR,14aR)-4,7-bis(dimethylamino)-1,12,13,14a-tetrahydroxy-10-(5-hydroxypentyl)-3,14-dioxo-4a,5,5a,6-tetrahydro-4H-pentacene-2-carboxamide |
|---|---|
| PubChem CID | 157237550 |
| Molecular Formula | C32H39N3O8 |
| Molecular Weight | 593.68 g/mol |
| Exact Mass | 593.27 |
| IUPAC Name | (4S,4aS,5aR,14aR)-4,7-bis(dimethylamino)-1,12,13,14a-tetrahydroxy-10-(5-hydroxypentyl)-3,14-dioxo-4a,5,5a,6-tetrahydro-4H-pentacene-2-carboxamide |
| SMILES | CN(C)c1c2c(c(O)c3cc(CCCCCO)ccc13)C(O)=C1C(=O)[C@]3(O)C(O)=C(C(N)=O)C(=O)[C@@H](N(C)C)[C@@H]3C[C@@H]1C2 |
| InChI | InChI=1S/C32H39N3O8/c1-34(2)24-17-10-9-15(8-6-5-7-11-36)12-18(17)26(37)22-19(24)13-16-14-20-25(35(3)4)28(39)23(31(33)42)30(41)32(20,43)29(40)21(16)27(22)38/h9-10,12,16,20,25,36-38,41,43H,5-8,11,13-14H2,1-4H3,(H2,33,42)/t16-,20-,25-,32-/m0/s1 |
| InChIKey | ZXZBCBRGPVORLN-XCZMHNGLSA-N |
| XLogP | 1.89 |
| TPSA | 184.86 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.68 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|