C30H34N2O7 — CID 157361070
(4S,4aS,5aR,14aR)-4-(dimethylamino)-1,12,13,14a-tetrahydroxy-3,14-dioxo-10-pentyl-4a,5,5a,6-tetrahydro-4H-pentacene-2-carboxamide (PubChem CID 157361070) has the molecular formula C30H34N2O7 and a molecular weight of 534.61 g/mol. Its IUPAC name is (4S,4aS,5aR,14aR)-4-(dimethylamino)-1,12,13,14a-tetrahydroxy-3,14-dioxo-10-pentyl-4a,5,5a,6-tetrahydro-4H-pentacene-2-carboxamide.
| Compound Name | (4S,4aS,5aR,14aR)-4-(dimethylamino)-1,12,13,14a-tetrahydroxy-3,14-dioxo-10-pentyl-4a,5,5a,6-tetrahydro-4H-pentacene-2-carboxamide |
|---|---|
| PubChem CID | 157361070 |
| Molecular Formula | C30H34N2O7 |
| Molecular Weight | 534.61 g/mol |
| Exact Mass | 534.24 |
| IUPAC Name | (4S,4aS,5aR,14aR)-4-(dimethylamino)-1,12,13,14a-tetrahydroxy-3,14-dioxo-10-pentyl-4a,5,5a,6-tetrahydro-4H-pentacene-2-carboxamide |
| SMILES | CCCCCc1ccc2cc3c(c(O)c2c1)C(O)=C1C(=O)[C@]2(O)C(O)=C(C(N)=O)C(=O)[C@@H](N(C)C)[C@@H]2C[C@@H]1C3 |
| InChI | InChI=1S/C30H34N2O7/c1-4-5-6-7-14-8-9-15-11-16-12-17-13-19-23(32(2)3)26(35)22(29(31)38)28(37)30(19,39)27(36)21(17)25(34)20(16)24(33)18(15)10-14/h8-11,17,19,23,33-34,37,39H,4-7,12-13H2,1-3H3,(H2,31,38)/t17-,19-,23-,30-/m0/s1 |
| InChIKey | VALJWZVQJSTIBC-FVJNVVATSA-N |
| XLogP | 2.85 |
| TPSA | 161.39 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.61 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|