C30H30N4O7 — CID 88572381
(4S,4aS,5aR,14aR)-4-(dimethylamino)-1,12,13,14a-tetrahydroxy-10-[(3-isocyanoazetidin-1-yl)methyl]-3,14-dioxo-4a,5,5a,6-tetrahydro-4H-pentacene-2-carboxamide (PubChem CID 88572381) has the molecular formula C30H30N4O7 and a molecular weight of 558.59 g/mol. Its IUPAC name is (4S,4aS,5aR,14aR)-4-(dimethylamino)-1,12,13,14a-tetrahydroxy-10-[(3-isocyanoazetidin-1-yl)methyl]-3,14-dioxo-4a,5,5a,6-tetrahydro-4H-pentacene-2-carboxamide.
| Compound Name | (4S,4aS,5aR,14aR)-4-(dimethylamino)-1,12,13,14a-tetrahydroxy-10-[(3-isocyanoazetidin-1-yl)methyl]-3,14-dioxo-4a,5,5a,6-tetrahydro-4H-pentacene-2-carboxamide |
|---|---|
| PubChem CID | 88572381 |
| Molecular Formula | C30H30N4O7 |
| Molecular Weight | 558.59 g/mol |
| Exact Mass | 558.21 |
| IUPAC Name | (4S,4aS,5aR,14aR)-4-(dimethylamino)-1,12,13,14a-tetrahydroxy-10-[(3-isocyanoazetidin-1-yl)methyl]-3,14-dioxo-4a,5,5a,6-tetrahydro-4H-pentacene-2-carboxamide |
| SMILES | [C-]#[N+]C1CN(Cc2ccc3cc4c(c(O)c3c2)C(O)=C2C(=O)[C@]3(O)C(O)=C(C(N)=O)C(=O)[C@@H](N(C)C)[C@@H]3C[C@@H]2C4)C1 |
| InChI | InChI=1S/C30H30N4O7/c1-32-17-11-34(12-17)10-13-4-5-14-7-15-8-16-9-19-23(33(2)3)26(37)22(29(31)40)28(39)30(19,41)27(38)21(16)25(36)20(15)24(35)18(14)6-13/h4-7,16-17,19,23,35-36,39,41H,8-12H2,2-3H3,(H2,31,40)/t16-,19-,23-,30-/m0/s1 |
| InChIKey | UBYPTLZZXYCAIU-RYUMRRJASA-N |
| XLogP | 1.22 |
| TPSA | 168.99 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.59 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|