C27H28N2O9 — CID 70832030
(4S,5aR,14aR)-4-(dimethylamino)-1,12,13,14a-tetrahydroxy-10-(hydroxymethyl)-7-methoxy-3,14-dioxo-4a,5,5a,6-tetrahydro-4H-pentacene-2-carboxamide (PubChem CID 70832030) has the molecular formula C27H28N2O9 and a molecular weight of 524.53 g/mol. Its IUPAC name is (4S,5aR,14aR)-4-(dimethylamino)-1,12,13,14a-tetrahydroxy-10-(hydroxymethyl)-7-methoxy-3,14-dioxo-4a,5,5a,6-tetrahydro-4H-pentacene-2-carboxamide.
| Compound Name | (4S,5aR,14aR)-4-(dimethylamino)-1,12,13,14a-tetrahydroxy-10-(hydroxymethyl)-7-methoxy-3,14-dioxo-4a,5,5a,6-tetrahydro-4H-pentacene-2-carboxamide |
|---|---|
| PubChem CID | 70832030 |
| Molecular Formula | C27H28N2O9 |
| Molecular Weight | 524.53 g/mol |
| Exact Mass | 524.18 |
| IUPAC Name | (4S,5aR,14aR)-4-(dimethylamino)-1,12,13,14a-tetrahydroxy-10-(hydroxymethyl)-7-methoxy-3,14-dioxo-4a,5,5a,6-tetrahydro-4H-pentacene-2-carboxamide |
| SMILES | COc1c2c(c(O)c3cc(CO)ccc13)C(O)=C1C(=O)[C@]3(O)C(O)=C(C(N)=O)C(=O)[C@@H](N(C)C)C3C[C@@H]1C2 |
| InChI | InChI=1S/C27H28N2O9/c1-29(2)19-15-8-11-7-14-17(20(31)13-6-10(9-30)4-5-12(13)23(14)38-3)21(32)16(11)24(34)27(15,37)25(35)18(22(19)33)26(28)36/h4-6,11,15,19,30-32,35,37H,7-9H2,1-3H3,(H2,28,36)/t11-,15?,19-,27-/m0/s1 |
| InChIKey | GOABDJOPOINRLC-LAQBOYLASA-N |
| XLogP | 0.62 |
| TPSA | 190.85 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.53 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|