C31H36N2O7 — CID 158901867
(4S,4aS,5aR,14aR)-4-(dimethylamino)-8-(3,3-dimethylbutyl)-1,12,13,14a-tetrahydroxy-3,14-dioxo-4a,5,5a,6-tetrahydro-4H-pentacene-2-carboxamide (PubChem CID 158901867) has the molecular formula C31H36N2O7 and a molecular weight of 548.64 g/mol. Its IUPAC name is (4S,4aS,5aR,14aR)-4-(dimethylamino)-8-(3,3-dimethylbutyl)-1,12,13,14a-tetrahydroxy-3,14-dioxo-4a,5,5a,6-tetrahydro-4H-pentacene-2-carboxamide.
| Compound Name | (4S,4aS,5aR,14aR)-4-(dimethylamino)-8-(3,3-dimethylbutyl)-1,12,13,14a-tetrahydroxy-3,14-dioxo-4a,5,5a,6-tetrahydro-4H-pentacene-2-carboxamide |
|---|---|
| PubChem CID | 158901867 |
| Molecular Formula | C31H36N2O7 |
| Molecular Weight | 548.64 g/mol |
| Exact Mass | 548.25 |
| IUPAC Name | (4S,4aS,5aR,14aR)-4-(dimethylamino)-8-(3,3-dimethylbutyl)-1,12,13,14a-tetrahydroxy-3,14-dioxo-4a,5,5a,6-tetrahydro-4H-pentacene-2-carboxamide |
| SMILES | CN(C)[C@@H]1C(=O)C(C(N)=O)=C(O)[C@@]2(O)C(=O)C3=C(O)c4c(cc5c(CCC(C)(C)C)cccc5c4O)C[C@H]3C[C@@H]12 |
| InChI | InChI=1S/C31H36N2O7/c1-30(2,3)10-9-14-7-6-8-17-18(14)12-15-11-16-13-19-23(33(4)5)26(36)22(29(32)39)28(38)31(19,40)27(37)21(16)25(35)20(15)24(17)34/h6-8,12,16,19,23,34-35,38,40H,9-11,13H2,1-5H3,(H2,32,39)/t16-,19-,23-,31-/m0/s1 |
| InChIKey | MNWWDKFAUWXBPD-YIQPDBGMSA-N |
| XLogP | 3.10 |
| TPSA | 161.39 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.64 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|