C31H39N3O9 — CID 168801245
[(4aS,11aR,12aS)-3-(acetylcarbamoyl)-7-butoxy-1,10-bis(dimethylamino)-4a,6-dihydroxy-4,5-dioxo-11,11a,12,12a-tetrahydro-1H-tetracen-2-yl] acetate (PubChem CID 168801245) has the molecular formula C31H39N3O9 and a molecular weight of 597.67 g/mol. Its IUPAC name is [(4aS,11aR,12aS)-3-(acetylcarbamoyl)-7-butoxy-1,10-bis(dimethylamino)-4a,6-dihydroxy-4,5-dioxo-11,11a,12,12a-tetrahydro-1H-tetracen-2-yl] acetate.
| Compound Name | [(4aS,11aR,12aS)-3-(acetylcarbamoyl)-7-butoxy-1,10-bis(dimethylamino)-4a,6-dihydroxy-4,5-dioxo-11,11a,12,12a-tetrahydro-1H-tetracen-2-yl] acetate |
|---|---|
| PubChem CID | 168801245 |
| Molecular Formula | C31H39N3O9 |
| Molecular Weight | 597.67 g/mol |
| Exact Mass | 597.27 |
| IUPAC Name | [(4aS,11aR,12aS)-3-(acetylcarbamoyl)-7-butoxy-1,10-bis(dimethylamino)-4a,6-dihydroxy-4,5-dioxo-11,11a,12,12a-tetrahydro-1H-tetracen-2-yl] acetate |
| SMILES | CCCCOc1ccc(N(C)C)c2c1C(O)=C1C(=O)[C@]3(O)C(=O)C(C(=O)NC(C)=O)=C(OC(C)=O)C(N(C)C)[C@@H]3C[C@@H]1C2 |
| InChI | InChI=1S/C31H39N3O9/c1-8-9-12-42-21-11-10-20(33(4)5)18-13-17-14-19-25(34(6)7)27(43-16(3)36)24(30(40)32-15(2)35)29(39)31(19,41)28(38)22(17)26(37)23(18)21/h10-11,17,19,25,37,41H,8-9,12-14H2,1-7H3,(H,32,35,40)/t17-,19-,25?,31-/m0/s1 |
| InChIKey | GAZYALJGGRJDEV-ZYOLDEBESA-N |
| XLogP | 1.69 |
| TPSA | 162.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.67 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|