C29H33N3O10 — CID 162506286
[(5aR,6aS,7S,10aS)-9-(acetylcarbamoyl)-8-acetyloxy-4,7-bis(dimethylamino)-10a,12-dihydroxy-10,11-dioxo-5a,6,6a,7-tetrahydro-5H-tetracen-1-yl] acetate (PubChem CID 162506286) has the molecular formula C29H33N3O10 and a molecular weight of 583.59 g/mol. Its IUPAC name is [(5aR,6aS,7S,10aS)-9-(acetylcarbamoyl)-8-acetyloxy-4,7-bis(dimethylamino)-10a,12-dihydroxy-10,11-dioxo-5a,6,6a,7-tetrahydro-5H-tetracen-1-yl] acetate.
| Compound Name | [(5aR,6aS,7S,10aS)-9-(acetylcarbamoyl)-8-acetyloxy-4,7-bis(dimethylamino)-10a,12-dihydroxy-10,11-dioxo-5a,6,6a,7-tetrahydro-5H-tetracen-1-yl] acetate |
|---|---|
| PubChem CID | 162506286 |
| Molecular Formula | C29H33N3O10 |
| Molecular Weight | 583.59 g/mol |
| Exact Mass | 583.22 |
| IUPAC Name | [(5aR,6aS,7S,10aS)-9-(acetylcarbamoyl)-8-acetyloxy-4,7-bis(dimethylamino)-10a,12-dihydroxy-10,11-dioxo-5a,6,6a,7-tetrahydro-5H-tetracen-1-yl] acetate |
| SMILES | CC(=O)NC(=O)C1=C(OC(C)=O)[C@@H](N(C)C)[C@@H]2C[C@@H]3Cc4c(N(C)C)ccc(OC(C)=O)c4C(O)=C3C(=O)[C@]2(O)C1=O |
| InChI | InChI=1S/C29H33N3O10/c1-12(33)30-28(39)22-25(42-14(3)35)23(32(6)7)17-11-15-10-16-18(31(4)5)8-9-19(41-13(2)34)21(16)24(36)20(15)26(37)29(17,40)27(22)38/h8-9,15,17,23,36,40H,10-11H2,1-7H3,(H,30,33,39)/t15-,17-,23-,29-/m0/s1 |
| InChIKey | OMVLEOYBKXOMLI-DEENEESKSA-N |
| XLogP | 0.43 |
| TPSA | 179.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.59 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|