C25H29N3O8 — CID 58676849
(4S,4aS,5aR,12aR)-N-acetyl-4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 58676849) has the molecular formula C25H29N3O8 and a molecular weight of 499.52 g/mol. Its IUPAC name is (4S,4aS,5aR,12aR)-N-acetyl-4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4S,4aS,5aR,12aR)-N-acetyl-4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 58676849 |
| Molecular Formula | C25H29N3O8 |
| Molecular Weight | 499.52 g/mol |
| Exact Mass | 499.20 |
| IUPAC Name | (4S,4aS,5aR,12aR)-N-acetyl-4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | CC(=O)NC(=O)C1=C(O)[C@@]2(O)C(=O)C3=C(O)c4c(O)ccc(N(C)C)c4C[C@H]3C[C@H]2[C@H](N(C)C)C1=O |
| InChI | InChI=1S/C25H29N3O8/c1-10(29)26-24(35)18-21(32)19(28(4)5)13-9-11-8-12-14(27(2)3)6-7-15(30)17(12)20(31)16(11)22(33)25(13,36)23(18)34/h6-7,11,13,19,30-31,34,36H,8-9H2,1-5H3,(H,26,29,35)/t11-,13-,19-,25-/m0/s1 |
| InChIKey | OGRHEJKHMIXBBL-PMEOYTFPSA-N |
| XLogP | 0.21 |
| TPSA | 167.71 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.52 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|