C31H34N2O7 — CID 58647435
(4aS,5aR,12aR)-10-butoxy-7-[4-(dimethylamino)phenyl]-1,11,12a-trihydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 58647435) has the molecular formula C31H34N2O7 and a molecular weight of 546.62 g/mol. Its IUPAC name is (4aS,5aR,12aR)-10-butoxy-7-[4-(dimethylamino)phenyl]-1,11,12a-trihydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4aS,5aR,12aR)-10-butoxy-7-[4-(dimethylamino)phenyl]-1,11,12a-trihydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 58647435 |
| Molecular Formula | C31H34N2O7 |
| Molecular Weight | 546.62 g/mol |
| Exact Mass | 546.24 |
| IUPAC Name | (4aS,5aR,12aR)-10-butoxy-7-[4-(dimethylamino)phenyl]-1,11,12a-trihydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | CCCCOc1ccc(-c2ccc(N(C)C)cc2)c2c1C(O)=C1C(=O)[C@]3(O)C(O)=C(C(N)=O)C(=O)C[C@@H]3C[C@@H]1C2 |
| InChI | InChI=1S/C31H34N2O7/c1-4-5-12-40-23-11-10-20(16-6-8-19(9-7-16)33(2)3)21-14-17-13-18-15-22(34)26(30(32)38)29(37)31(18,39)28(36)24(17)27(35)25(21)23/h6-11,17-18,35,37,39H,4-5,12-15H2,1-3H3,(H2,32,38)/t17-,18+,31+/m1/s1 |
| InChIKey | WDJZOSIJVBHBMZ-QSDPREHASA-N |
| XLogP | 3.63 |
| TPSA | 150.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.62 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|