C32H35NO7 — CID 140506010
(4aS,5aR,12aR)-9-(4-butylphenyl)-1,10,11,12a-tetrahydroxy-3,12-dioxo-7-propan-2-yl-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 140506010) has the molecular formula C32H35NO7 and a molecular weight of 545.63 g/mol. Its IUPAC name is (4aS,5aR,12aR)-9-(4-butylphenyl)-1,10,11,12a-tetrahydroxy-3,12-dioxo-7-propan-2-yl-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4aS,5aR,12aR)-9-(4-butylphenyl)-1,10,11,12a-tetrahydroxy-3,12-dioxo-7-propan-2-yl-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 140506010 |
| Molecular Formula | C32H35NO7 |
| Molecular Weight | 545.63 g/mol |
| Exact Mass | 545.24 |
| IUPAC Name | (4aS,5aR,12aR)-9-(4-butylphenyl)-1,10,11,12a-tetrahydroxy-3,12-dioxo-7-propan-2-yl-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | CCCCc1ccc(-c2cc(C(C)C)c3c(c2O)C(O)=C2C(=O)[C@]4(O)C(O)=C(C(N)=O)C(=O)C[C@@H]4C[C@@H]2C3)cc1 |
| InChI | InChI=1S/C32H35NO7/c1-4-5-6-16-7-9-17(10-8-16)21-14-20(15(2)3)22-12-18-11-19-13-23(34)26(31(33)39)30(38)32(19,40)29(37)24(18)28(36)25(22)27(21)35/h7-10,14-15,18-19,35-36,38,40H,4-6,11-13H2,1-3H3,(H2,33,39)/t18-,19+,32+/m1/s1 |
| InChIKey | LDFMSEJFWIUPQM-MAZCQJGGSA-N |
| XLogP | 4.56 |
| TPSA | 158.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.63 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|