C21H20INO7 — CID 54722790
7-ethyl-1,10,11,12a-tetrahydroxy-9-iodo-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 54722790) has the molecular formula C21H20INO7 and a molecular weight of 525.30 g/mol. Its IUPAC name is 7-ethyl-1,10,11,12a-tetrahydroxy-9-iodo-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | 7-ethyl-1,10,11,12a-tetrahydroxy-9-iodo-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 54722790 |
| Molecular Formula | C21H20INO7 |
| Molecular Weight | 525.30 g/mol |
| Exact Mass | 525.03 |
| IUPAC Name | 7-ethyl-1,10,11,12a-tetrahydroxy-9-iodo-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | CCc1cc(I)c(O)c2c1CC1CC3CC(=O)C(C(N)=O)=C(O)C3(O)C(=O)C1=C2O |
| InChI | InChI=1S/C21H20INO7/c1-2-7-5-11(22)16(25)14-10(7)4-8-3-9-6-12(24)15(20(23)29)19(28)21(9,30)18(27)13(8)17(14)26/h5,8-9,25-26,28,30H,2-4,6H2,1H3,(H2,23,29) |
| InChIKey | OSHBEYDFJNGPHW-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 158.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.30 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|