C24H26N2O8 — CID 54722901
9-(acetamidomethyl)-7-ethyl-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 54722901) has the molecular formula C24H26N2O8 and a molecular weight of 470.48 g/mol. Its IUPAC name is 9-(acetamidomethyl)-7-ethyl-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | 9-(acetamidomethyl)-7-ethyl-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 54722901 |
| Molecular Formula | C24H26N2O8 |
| Molecular Weight | 470.48 g/mol |
| Exact Mass | 470.17 |
| IUPAC Name | 9-(acetamidomethyl)-7-ethyl-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | CCc1cc(CNC(C)=O)c(O)c2c1CC1CC3CC(=O)C(C(N)=O)=C(O)C3(O)C(=O)C1=C2O |
| InChI | InChI=1S/C24H26N2O8/c1-3-10-4-12(8-26-9(2)27)19(29)17-14(10)6-11-5-13-7-15(28)18(23(25)33)22(32)24(13,34)21(31)16(11)20(17)30/h4,11,13,29-30,32,34H,3,5-8H2,1-2H3,(H2,25,33)(H,26,27) |
| InChIKey | WZTJLGYEPKAFKV-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 187.25 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.48 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|