C23H24O7 — CID 122680454
(4aS,11aS,12aR)-3-acetyl-10-ethyl-4,4a,6,7-tetrahydroxy-8-methyl-11,11a,12,12a-tetrahydro-1H-tetracene-2,5-dione (PubChem CID 122680454) has the molecular formula C23H24O7 and a molecular weight of 412.44 g/mol. Its IUPAC name is (4aS,11aS,12aR)-3-acetyl-10-ethyl-4,4a,6,7-tetrahydroxy-8-methyl-11,11a,12,12a-tetrahydro-1H-tetracene-2,5-dione.
| Compound Name | (4aS,11aS,12aR)-3-acetyl-10-ethyl-4,4a,6,7-tetrahydroxy-8-methyl-11,11a,12,12a-tetrahydro-1H-tetracene-2,5-dione |
|---|---|
| PubChem CID | 122680454 |
| Molecular Formula | C23H24O7 |
| Molecular Weight | 412.44 g/mol |
| Exact Mass | 412.15 |
| IUPAC Name | (4aS,11aS,12aR)-3-acetyl-10-ethyl-4,4a,6,7-tetrahydroxy-8-methyl-11,11a,12,12a-tetrahydro-1H-tetracene-2,5-dione |
| SMILES | CCc1cc(C)c(O)c2c1C[C@@H]1C[C@@H]3CC(=O)C(C(C)=O)=C(O)[C@]3(O)C(=O)C1=C2O |
| InChI | InChI=1S/C23H24O7/c1-4-11-5-9(2)19(26)18-14(11)7-12-6-13-8-15(25)16(10(3)24)21(28)23(13,30)22(29)17(12)20(18)27/h5,12-13,26-28,30H,4,6-8H2,1-3H3/t12-,13+,23-/m0/s1 |
| InChIKey | LKPIJZCDDVDIEQ-BTELXILVSA-N |
| XLogP | 2.40 |
| TPSA | 132.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.44 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|